EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14NO5P |
| Net Charge | 0 |
| Average Mass | 271.209 |
| Monoisotopic Mass | 271.06096 |
| SMILES | NC(C(=O)O)(c1ccc(P(=O)(O)O)cc1)C1CC1 |
| InChI | InChI=1S/C11H14NO5P/c12-11(10(13)14,7-1-2-7)8-3-5-9(6-4-8)18(15,16)17/h3-7H,1-2,12H2,(H,13,14)(H2,15,16,17) |
| InChIKey | IGODGTDUQSMDQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-2-cyclopropyl-2-(4-phosphonophenyl)acetic acid (CHEBI:125380) is a α-amino acid (CHEBI:33704) |
| Manual Xrefs | Databases |
|---|---|
| LSM-36862 | LINCS |