EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H54N8 |
| Net Charge | 0 |
| Average Mass | 502.796 |
| Monoisotopic Mass | 502.44714 |
| SMILES | c1cc(CN2CCCNCCNCCCNCC2)ccc1CN1CCCNCCNCCCNCC1 |
| InChI | InChI=1S/C28H54N8/c1-9-29-15-17-31-13-3-21-35(23-19-33-11-1)25-27-5-7-28(8-6-27)26-36-22-4-14-32-18-16-30-10-2-12-34-20-24-36/h5-8,29-34H,1-4,9-26H2 |
| InChIKey | YIQPUIGJQJDJOS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. C-X-C chemokine receptor type 4 antagonist An antogonist that blocks C-X-C chemokine receptor type 4 (CXCR-4). anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plerixafor (CHEBI:125354) has functional parent 1,4,8,11-tetraazacyclotetradecane (CHEBI:37401) |
| plerixafor (CHEBI:125354) has role anti-HIV agent (CHEBI:64946) |
| plerixafor (CHEBI:125354) has role antineoplastic agent (CHEBI:35610) |
| plerixafor (CHEBI:125354) has role C-X-C chemokine receptor type 4 antagonist (CHEBI:145438) |
| plerixafor (CHEBI:125354) has role immunological adjuvant (CHEBI:50847) |
| plerixafor (CHEBI:125354) is a azacycloalkane (CHEBI:37949) |
| plerixafor (CHEBI:125354) is a azamacrocycle (CHEBI:52898) |
| plerixafor (CHEBI:125354) is a benzenes (CHEBI:22712) |
| plerixafor (CHEBI:125354) is a crown amine (CHEBI:37411) |
| plerixafor (CHEBI:125354) is a secondary amino compound (CHEBI:50995) |
| plerixafor (CHEBI:125354) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1,1'-(benzene-1,4-diyldimethanediyl)bis(1,4,8,11-tetraazacyclotetradecane) |
| INNs | Source |
|---|---|
| plerixafor | WHO MedNet |
| plerixafor | WHO MedNet |
| plérixafor | WHO MedNet |
| plerixaforum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,1'-[1,4-phenylenebis(methylene)]bis(1,4,8,11-tetraazacyclotetradecane) | IUPAC |
| 1-[[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phenyl]methyl]-1,4,8,11-tetrazacyclotetradecane | ChEBI |
| AMD 3100 | ChEBI |
| AMD-3100 | DrugBank |
| AMD3100 | DrugBank |
| JKL 169 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Mozobil | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4410 | DrugCentral |
| D08971 | KEGG DRUG |
| DB06809 | DrugBank |
| HMDB0015681 | HMDB |
| LSM-36826 | LINCS |
| Plerixafor | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:110078-46-1 | ChemIDplus |
| Citations |
|---|