EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO5 |
| Net Charge | 0 |
| Average Mass | 213.189 |
| Monoisotopic Mass | 213.06372 |
| SMILES | O=C(O)[C@H](Cc1ccc(O)cc1)N(O)O |
| InChI | InChI=1S/C9H11NO5/c11-7-3-1-6(2-4-7)5-8(9(12)13)10(14)15/h1-4,8,11,14-15H,5H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | QPHSFUGCBGILSS-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dihydroxy-L-tyrosine (CHEBI:12532) is a N,N-dihydroxy-α-amino acid (CHEBI:50766) |
| N,N-dihydroxy-L-tyrosine (CHEBI:12532) is a L-tyrosine derivative (CHEBI:27177) |
| N,N-dihydroxy-L-tyrosine (CHEBI:12532) is conjugate acid of N,N-dihydroxy-L-tyrosinate (CHEBI:57270) |
| Incoming Relation(s) |
| N,N-dihydroxy-L-tyrosinate (CHEBI:57270) is conjugate base of N,N-dihydroxy-L-tyrosine (CHEBI:12532) |
| IUPAC Name |
|---|
| N,N-dihydroxy-L-tyrosine |
| Synonyms | Source |
|---|---|
| (2S)-2-(dihydroxyamino)-3-(4-hydroxyphenyl)propanoic acid | IUPAC |
| (S)-2-(dihydroxyamino)-3-(4-hydroxyphenyl)propionic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15503 | KEGG COMPOUND |