EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H43N5O5Si |
| Net Charge | 0 |
| Average Mass | 665.867 |
| Monoisotopic Mass | 665.30335 |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCn3cc(CCO)nn3)O[C@@]3(C(=O)N(Cc4cccc(N5CCC5=O)c4)c4ccccc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C37H43N5O5Si/c1-25-35(48(3,4)30-14-12-29(46-2)13-15-30)33(16-19-40-24-27(18-21-43)38-39-40)47-37(25)31-10-5-6-11-32(31)42(36(37)45)23-26-8-7-9-28(22-26)41-20-17-34(41)44/h5-15,22,24-25,33,35,43H,16-21,23H2,1-4H3/t25-,33+,35-,37+/m1/s1 |
| InChIKey | FTKXCBYAQTWBTF-HSLFHSRNSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxyethyl)-1-triazolyl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[3-(2-oxo-1-azetidinyl)phenyl]methyl]-2-spiro[indole-3,2'-oxolane]one (CHEBI:125235) is a monobactam (CHEBI:50695) |
| Manual Xrefs | Databases |
|---|---|
| LSM-36703 | LINCS |