EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30N2O5 |
| Net Charge | 0 |
| Average Mass | 426.513 |
| Monoisotopic Mass | 426.21547 |
| SMILES | COCCCNC(=O)[C@@]1(Cc2ccccc2)COC(c2ccc(OCCCO)cc2)=N1 |
| InChI | InChI=1S/C24H30N2O5/c1-29-15-5-13-25-23(28)24(17-19-7-3-2-4-8-19)18-31-22(26-24)20-9-11-21(12-10-20)30-16-6-14-27/h2-4,7-12,27H,5-6,13-18H2,1H3,(H,25,28)/t24-/m1/s1 |
| InChIKey | MBUSULDPCTYKRU-XMMPIXPASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-2-[4-(3-hydroxypropoxy)phenyl]-N-(3-methoxypropyl)-4-(phenylmethyl)-5H-oxazole-4-carboxamide (CHEBI:125230) is a amphetamines (CHEBI:35338) |
| Manual Xrefs | Databases |
|---|---|
| LSM-36698 | LINCS |