EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | CNCC(O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO/c1-10-7-9(11)8-5-3-2-4-6-8/h2-6,9-11H,7H2,1H3 |
| InChIKey | ZCTYHONEGJTYQV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (6775642) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylphenylethanolamine (CHEBI:16913) has role human metabolite (CHEBI:77746) |
| N-methylphenylethanolamine (CHEBI:16913) has role plant metabolite (CHEBI:76924) |
| N-methylphenylethanolamine (CHEBI:16913) is a alkaloid (CHEBI:22315) |
| N-methylphenylethanolamine (CHEBI:16913) is a phenylethanolamines (CHEBI:25990) |
| N-methylphenylethanolamine (CHEBI:16913) is conjugate base of N-methylphenylethanolaminium (CHEBI:57946) |
| Incoming Relation(s) |
| N-methylphenylethanolaminium (CHEBI:57946) is conjugate acid of N-methylphenylethanolamine (CHEBI:16913) |
| IUPAC Name |
|---|
| 2-(methylamino)-1-phenylethanol |
| Synonyms | Source |
|---|---|
| (+-)-alpha-((Methylamino)methyl)benzenemethanol | ChemIDplus |
| Benzyl alcohol, alpha-((methylamino)methyl)-, dl- | ChemIDplus |
| (+-)-Halostachine | ChemIDplus |
| N-Methylphenylethanolamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03711 | KEGG COMPOUND |
| Halostachine | Wikipedia |
| HMDB0001387 | HMDB |
| LSM-36938 | LINCS |
| N-METHYLPHENYLETHANOLAMINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1072841 | Reaxys |
| CAS:68579-60-2 | KEGG COMPOUND |
| CAS:68579-60-2 | ChemIDplus |
| Citations |
|---|