EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H34N8O5 |
| Net Charge | 0 |
| Average Mass | 598.664 |
| Monoisotopic Mass | 598.26522 |
| SMILES | COCCCNC(=O)[C@]1(Cc2ccccc2CN=[N+]=[N-])N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C31H34N8O5/c1-42-18-6-16-34-30(41)31(20-23-8-2-3-9-24(23)21-35-38-32)28(26-10-4-5-11-27(26)37-39-33)44-29(36-31)22-12-14-25(15-13-22)43-19-7-17-40/h2-5,8-15,28,40H,6-7,16-21H2,1H3,(H,34,41)/t28-,31-/m1/s1 |
| InChIKey | FMOSHIVCPVHAAN-GRKNLSHJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R,5R)-4-[[2-(azidomethyl)phenyl]methyl]-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-(3-methoxypropyl)-5H-oxazole-4-carboxamide (CHEBI:125225) is a amphetamines (CHEBI:35338) |
| Manual Xrefs | Databases |
|---|---|
| LSM-36693 | LINCS |