EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H33N5O4 |
| Net Charge | 0 |
| Average Mass | 575.669 |
| Monoisotopic Mass | 575.25325 |
| SMILES | [N-]=[N+]=NCc1ccccc1C[C@]1(C(=O)NCc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C34H33N5O4/c35-39-37-24-29-15-8-7-14-28(29)22-34(33(41)36-23-25-10-3-1-4-11-25)31(26-12-5-2-6-13-26)43-32(38-34)27-16-18-30(19-17-27)42-21-9-20-40/h1-8,10-19,31,40H,9,20-24H2,(H,36,41)/t31-,34-/m0/s1 |
| InChIKey | QXLFBUYYHPSKGL-VBTAUBHQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4S,5S)-4-[[2-(azidomethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-N-(phenylmethyl)-5H-oxazole-4-carboxamide (CHEBI:125192) is a amphetamines (CHEBI:35338) |
| Manual Xrefs | Databases |
|---|---|
| LSM-36658 | LINCS |