EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N2O5Si |
| Net Charge | 0 |
| Average Mass | 570.762 |
| Monoisotopic Mass | 570.25500 |
| SMILES | COc1ccc([Si](C)(C)[C@@H]2[C@@H](CCO)O[C@]3(C(=O)N(Cc4ccc(N5CCC5=O)cc4)c4ccccc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C33H38N2O5Si/c1-22-31(41(3,4)26-15-13-25(39-2)14-16-26)29(18-20-36)40-33(22)27-7-5-6-8-28(27)35(32(33)38)21-23-9-11-24(12-10-23)34-19-17-30(34)37/h5-16,22,29,31,36H,17-21H2,1-4H3/t22-,29+,31-,33+/m0/s1 |
| InChIKey | INJZEKVZBKVNHN-ZVTQMECVSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(2-oxo-1-azetidinyl)phenyl]methyl]-2-spiro[indole-3,2'-oxolane]one (CHEBI:125184) is a monobactam (CHEBI:50695) |
| Manual Xrefs | Databases |
|---|---|
| LSM-36650 | LINCS |