EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H32FN5O4 |
| Net Charge | 0 |
| Average Mass | 557.626 |
| Monoisotopic Mass | 557.24383 |
| SMILES | COc1ccc2c3c(nc2c1)[C@H](CO)N(C(=O)Nc1ccc(F)cc1)CC31CCN(C(=O)Cc2ccncc2)CC1 |
| InChI | InChI=1S/C31H32FN5O4/c1-41-23-6-7-24-25(17-23)35-29-26(18-38)37(30(40)34-22-4-2-21(32)3-5-22)19-31(28(24)29)10-14-36(15-11-31)27(39)16-20-8-12-33-13-9-20/h2-9,12-13,17,26,35,38H,10-11,14-16,18-19H2,1H3,(H,34,40)/t26-/m0/s1 |
| InChIKey | HGIIRBPWYAQQMQ-SANMLTNESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R)-N-(4-fluorophenyl)-1-(hydroxymethyl)-7-methoxy-1'-(1-oxo-2-pyridin-4-ylethyl)-2-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]carboxamide (CHEBI:124972) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-36432 | LINCS |