EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25ClN2O |
| Net Charge | 0 |
| Average Mass | 380.919 |
| Monoisotopic Mass | 380.16554 |
| SMILES | O=C(NCc1ccncc1)C12CC3CC(C1)CC(c1ccc(Cl)cc1)(C3)C2 |
| InChI | InChI=1S/C23H25ClN2O/c24-20-3-1-19(2-4-20)22-10-17-9-18(11-22)13-23(12-17,15-22)21(27)26-14-16-5-7-25-8-6-16/h1-8,17-18H,9-15H2,(H,26,27) |
| InChIKey | CAOTVXGYTWCKQE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)-1-adamantanecarboxamide (CHEBI:124965) has role antineoplastic agent (CHEBI:35610) |
| 3-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)-1-adamantanecarboxamide (CHEBI:124965) is a organochlorine compound (CHEBI:36683) |
| INN | Source |
|---|---|
| opaganib | WHO MedNet |
| Synonyms | Source |
|---|---|
| abc-294640 | ChEMBL |
| Abc-294640 | ChEMBL |
| Abc294640 | ChEMBL |
| ABC 294640 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-36424 | LINCS |
| Citations |
|---|