EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:124921 - GSK126
| Formula | C31H38N6O2 |
| Net Charge | 0 |
| Average Mass | 526.685 |
| Monoisotopic Mass | 526.30562 |
| SMILES | CC[C@H](C)n1cc(C)c2c(C(=O)NCc3c(C)cc(C)nc3=O)cc(-c3ccc(N4CCNCC4)nc3)cc21 |
| InChI | InChI=1S/C31H38N6O2/c1-6-22(5)37-18-20(3)29-25(30(38)34-17-26-19(2)13-21(4)35-31(26)39)14-24(15-27(29)37)23-7-8-28(33-16-23)36-11-9-32-10-12-36/h7-8,13-16,18,22,32H,6,9-12,17H2,1-5H3,(H,34,38)(H,35,39)/t22-/m0/s1 |
| InChIKey | FKSFKBQGSFSOSM-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. EC 2.1.1.43 (enhancer of zeste homolog 2) inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of Enhancer of zeste homolog 2 (EZH2), a histone-lysine N-methyltransferase (EC 2.1.1.43). |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK126 (CHEBI:124921) has role angiogenesis inhibitor (CHEBI:48422) |
| GSK126 (CHEBI:124921) has role anti-obesity agent (CHEBI:74518) |
| GSK126 (CHEBI:124921) has role antiatherosclerotic agent (CHEBI:145947) |
| GSK126 (CHEBI:124921) has role antineoplastic agent (CHEBI:35610) |
| GSK126 (CHEBI:124921) has role EC 2.1.1.43 (enhancer of zeste homolog 2) inhibitor (CHEBI:167694) |
| GSK126 (CHEBI:124921) has role neuroprotective agent (CHEBI:63726) |
| GSK126 (CHEBI:124921) is a N-arylpiperazine (CHEBI:46848) |
| GSK126 (CHEBI:124921) is a methylindole (CHEBI:38460) |
| GSK126 (CHEBI:124921) is a pyridines (CHEBI:26421) |
| GSK126 (CHEBI:124921) is a pyridone (CHEBI:38183) |
| GSK126 (CHEBI:124921) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 1-[(2S)-butan-2-yl]-N-[(4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl]-3-methyl-6-[6-(piperazin-1-yl)pyridin-3-yl]-1H-indole-4-carboxamide |
| Synonyms | Source |
|---|---|
| GSK 2816126 | ChEBI |
| GSK-126 | ChEBI |
| GSK 126 | ChEBI |
| GSK-2816126 | ChEBI |
| GSK2816126 | ChEBI |
| (S)-1-(sec-butyl)-N-((4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)-3-methyl-6-(6-(piperazin-1-yl)pyridin-3-yl)-1H-indole-4-carboxamide | ChEBI |
| Citations |
|---|