EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22BrN5O3 |
| Net Charge | 0 |
| Average Mass | 436.310 |
| Monoisotopic Mass | 435.09060 |
| SMILES | Cc1cnc(NC(=O)Nc2cc(Br)c(C)cc2OC[C@@H]2CNCCO2)cn1 |
| InChI | InChI=1S/C18H22BrN5O3/c1-11-5-16(27-10-13-8-20-3-4-26-13)15(6-14(11)19)23-18(25)24-17-9-21-12(2)7-22-17/h5-7,9,13,20H,3-4,8,10H2,1-2H3,(H2,22,23,24,25)/t13-/m0/s1 |
| InChIKey | SYYBDNPGDKKJDU-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[5-bromo-4-methyl-2-[[(2S)-2-morpholinyl]methoxy]phenyl]-3-(5-methyl-2-pyrazinyl)urea (CHEBI:124917) has role antineoplastic agent (CHEBI:35610) |
| 1-[5-bromo-4-methyl-2-[[(2S)-2-morpholinyl]methoxy]phenyl]-3-(5-methyl-2-pyrazinyl)urea (CHEBI:124917) is a ureas (CHEBI:47857) |
| INN | Source |
|---|---|
| rabusertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| IC-83 | ChEMBL |
| LY-2603618 | ChEMBL |
| LY2603618 | ChEMBL |
| rabusertib | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-36359 | LINCS |
| Citations |
|---|