EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N6O |
| Net Charge | 0 |
| Average Mass | 270.296 |
| Monoisotopic Mass | 270.12291 |
| SMILES | CCn1c(=O)c(-c2ccnn2)cc2c(C)nc(N)nc21 |
| InChI | InChI=1S/C13H14N6O/c1-3-19-11-8(7(2)16-13(14)17-11)6-9(12(19)20)10-4-5-15-18-10/h4-6H,3H2,1-2H3,(H,15,18)(H2,14,16,17) |
| InChIKey | RGHYDLZMTYDBDT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-8-ethyl-4-methyl-6-(1H-pyrazol-5-yl)-7-pyrido[2,3-d]pyrimidinone (CHEBI:124914) has role antineoplastic agent (CHEBI:35610) |
| 2-amino-8-ethyl-4-methyl-6-(1H-pyrazol-5-yl)-7-pyrido[2,3-d]pyrimidinone (CHEBI:124914) is a pyrazolopyridine (CHEBI:46699) |
| INN | Source |
|---|---|
| voxtalisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| SAR-245409 | ChEMBL |
| SAR245409 | ChEMBL |
| voxtalisib | ChEMBL |
| XL765 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-36356 | LINCS |
| Citations |
|---|