EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H43N3O6 |
| Net Charge | 0 |
| Average Mass | 565.711 |
| Monoisotopic Mass | 565.31519 |
| SMILES | C[C@@H]1CN([C@H](C)CO)C(=O)Cc2cc(NC(=O)C3CCCCC3)ccc2O[C@@H]1CN(C)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H43N3O6/c1-21-17-35(22(2)20-36)30(37)16-26-15-27(33-31(38)24-7-5-4-6-8-24)13-14-28(26)41-29(21)19-34(3)18-23-9-11-25(12-10-23)32(39)40/h9-15,21-22,24,29,36H,4-8,16-20H2,1-3H3,(H,33,38)(H,39,40)/t21-,22-,29-/m1/s1 |
| InChIKey | HSFKBSVDQSMDKQ-IEOSBIPESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[[[(2S,3R)-9-[[cyclohexyl(oxo)methyl]amino]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl-methylamino]methyl]benzoic acid (CHEBI:124900) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-36342 | LINCS |