EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13NO9P |
| Net Charge | -3 |
| Average Mass | 346.208 |
| Monoisotopic Mass | 346.03444 |
| SMILES | O=C([O-])c1ccccc1N[C@@H]1O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16NO9P/c14-9-8(5-21-23(18,19)20)22-11(10(9)15)13-7-4-2-1-3-6(7)12(16)17/h1-4,8-11,13-15H,5H2,(H,16,17)(H2,18,19,20)/p-3/t8-,9-,10-,11-/m1/s1 |
| InChIKey | PMFMJXPRNJUYMB-GWOFURMSSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(5-phosphonato-β-D-ribosyl)anthranilate (CHEBI:18277) has functional parent anthranilate (CHEBI:16567) |
| N-(5-phosphonato-β-D-ribosyl)anthranilate (CHEBI:18277) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| N-(5-phosphonato-β-D-ribosyl)anthranilate (CHEBI:18277) is a organophosphate oxoanion (CHEBI:58945) |
| N-(5-phosphonato-β-D-ribosyl)anthranilate (CHEBI:18277) is conjugate base of N-(5-phospho-β-D-ribosyl)anthranilic acid (CHEBI:7091) |
| Incoming Relation(s) |
| N-(5-phospho-β-D-ribosyl)anthranilic acid (CHEBI:7091) is conjugate acid of N-(5-phosphonato-β-D-ribosyl)anthranilate (CHEBI:18277) |
| IUPAC Name |
|---|
| N-(2-carboxylatophenyl)-β-D-ribofuranosylamine 5-phosphate |
| Synonyms | Source |
|---|---|
| N-(2-carboxylatophenyl)-5-O-phosphonato-β-D-ribofuranosylamine | ChEBI |
| N-(5-Phospho-beta-D-ribosyl)anthranilate | KEGG COMPOUND |
| N-(5-Phospho-D-ribosyl)anthranilate | KEGG COMPOUND |
| N-(5'-Phosphoribosyl)anthranilate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| N-(5-phospho-β-D-ribosyl)anthranilate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C04302 | KEGG COMPOUND |