EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37N3O5 |
| Net Charge | 0 |
| Average Mass | 483.609 |
| Monoisotopic Mass | 483.27332 |
| SMILES | C[C@@H]1CN([C@H](C)CO)C(=O)Cc2cc(N(C)C)ccc2O[C@H]1CN(C)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H37N3O5/c1-18-14-30(19(2)17-31)26(32)13-22-12-23(28(3)4)10-11-24(22)35-25(18)16-29(5)15-20-6-8-21(9-7-20)27(33)34/h6-12,18-19,25,31H,13-17H2,1-5H3,(H,33,34)/t18-,19-,25+/m1/s1 |
| InChIKey | AULWKOGNKWVKDZ-RRQZXNHTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[[[(2R,3R)-9-(dimethylamino)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl-methylamino]methyl]benzoic acid (CHEBI:124229) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-35671 | LINCS |