EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | NC[C@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c6-2-3(7)1-4(8)5(9)10/h3,7H,1-2,6H2,(H,9,10)/t3-/m1/s1 |
| InChIKey | ICMJZHFYQVZYQN-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Oxo-4-hydroxy-5-aminovalerate (CHEBI:1241) is a hydroxy fatty acid (CHEBI:24654) |
| Synonym | Source |
|---|---|
| 2-Oxo-4-hydroxy-5-aminovalerate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05941 | KEGG COMPOUND |