EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N3O2 |
| Net Charge | 0 |
| Average Mass | 235.287 |
| Monoisotopic Mass | 235.13208 |
| SMILES | Cc1cc(C)nc(N2CCC(C(=O)O)CC2)n1 |
| InChI | InChI=1S/C12H17N3O2/c1-8-7-9(2)14-12(13-8)15-5-3-10(4-6-15)11(16)17/h7,10H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | HKGJIAQYOSHPHU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4,6-dimethyl-2-pyrimidinyl)-4-piperidinecarboxylic acid (CHEBI:123404) is a carboxylic acid (CHEBI:33575) |
| 1-(4,6-dimethyl-2-pyrimidinyl)-4-piperidinecarboxylic acid (CHEBI:123404) is a piperidines (CHEBI:26151) |
| Manual Xrefs | Databases |
|---|---|
| LSM-34846 | LINCS |