EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8ClNO3S |
| Net Charge | 0 |
| Average Mass | 281.720 |
| Monoisotopic Mass | 280.99134 |
| SMILES | O=C(OCC(=O)c1ccc(Cl)s1)c1ccccn1 |
| InChI | InChI=1S/C12H8ClNO3S/c13-11-5-4-10(18-11)9(15)7-17-12(16)8-3-1-2-6-14-8/h1-6H,7H2 |
| InChIKey | AKQCRDHWBDZILH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-pyridinecarboxylic acid [2-(5-chloro-2-thiophenyl)-2-oxoethyl] ester (CHEBI:123385) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-pyridinecarboxylic acid [2-(5-chloro-2-thiophenyl)-2-oxoethyl] ester (CHEBI:123385) is a pyridines (CHEBI:26421) |
| Manual Xrefs | Databases |
|---|---|
| LSM-34827 | LINCS |