EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:123218 - 3-phenyl-3-(1-tetrazolyl)propanoic acid
| Formula | C10H10N4O2 |
| Net Charge | 0 |
| Average Mass | 218.216 |
| Monoisotopic Mass | 218.08038 |
| SMILES | O=C(O)CC(c1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C10H10N4O2/c15-10(16)6-9(14-7-11-12-13-14)8-4-2-1-3-5-8/h1-5,7,9H,6H2,(H,15,16) |
| InChIKey | IPEATIREFBKQKS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-phenyl-3-(1-tetrazolyl)propanoic acid (CHEBI:123218) is a benzenes (CHEBI:22712) |
| 3-phenyl-3-(1-tetrazolyl)propanoic acid (CHEBI:123218) is a monocarboxylic acid (CHEBI:25384) |
| Manual Xrefs | Databases |
|---|---|
| LSM-34660 | LINCS |