EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H41N3O2 |
| Net Charge | 0 |
| Average Mass | 427.633 |
| Monoisotopic Mass | 427.31988 |
| SMILES | CCCC[C@@H](CNC)NC[C@H](Cc1ccc(O)cc1)NCCc1ccc(OCC)cc1 |
| InChI | InChI=1S/C26H41N3O2/c1-4-6-7-23(19-27-3)29-20-24(18-22-8-12-25(30)13-9-22)28-17-16-21-10-14-26(15-11-21)31-5-2/h8-15,23-24,27-30H,4-7,16-20H2,1-3H3/t23-,24-/m0/s1 |
| InChIKey | UKJJBOIZPUYFDB-ZEQRLZLVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[(2S)-2-[2-(4-ethoxyphenyl)ethylamino]-3-[[(2S)-1-(methylamino)hexan-2-yl]amino]propyl]phenol (CHEBI:123180) is a amphetamines (CHEBI:35338) |
| Manual Xrefs | Databases |
|---|---|
| LSM-34622 | LINCS |