EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N4O2 |
| Net Charge | 0 |
| Average Mass | 260.297 |
| Monoisotopic Mass | 260.12733 |
| SMILES | COc1ccc(Cc2cnc(N)nc2N)cc1OC |
| InChI | InChI=1S/C13H16N4O2/c1-18-10-4-3-8(6-11(10)19-2)5-9-7-16-13(15)17-12(9)14/h3-4,6-7H,5H2,1-2H3,(H4,14,15,16,17) |
| InChIKey | LDBTVAXGKYIFHO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diaveridine (CHEBI:123115) has role antiparasitic agent (CHEBI:35442) |
| diaveridine (CHEBI:123115) has role drug allergen (CHEBI:88188) |
| diaveridine (CHEBI:123115) is a aminopyrimidine (CHEBI:38338) |
| IUPAC Name |
|---|
| 5-(3,4-dimethoxybenzyl)pyrimidine-2,4-diamine |
| INNs | Source |
|---|---|
| diaveridine | ChemIDplus |
| diaveridina | ChemIDplus |
| diaveridinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-(3,4-Dimethoxy-benzyl)-pyrimidine-2,4-diamine | ChEMBL |
| 2,4-Diamino-5-(3,4-dimethoxybenzyl)pyrimidine | ChemIDplus |
| 2,4-Diamino-5-veratrylpyrimidine | ChemIDplus |
| 5-((3,4-Dimethoxyphenyl)methyl)-2,4-pyrimidinediamine | ChemIDplus |
| Diaveridin | ChemIDplus |
| Citations |
|---|