EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O7P2 |
| Net Charge | 0 |
| Average Mass | 246.092 |
| Monoisotopic Mass | 246.00583 |
| SMILES | CC(C)=CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H12O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8) |
| InChIKey | CBIDRCWHNCKSTO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | phosphoantigen Any antigen that is a phosphorylated microbial metabolite which activates an immune response in humans. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prenyl diphosphate (CHEBI:16057) has role Escherichia coli metabolite (CHEBI:76971) |
| prenyl diphosphate (CHEBI:16057) has role epitope (CHEBI:53000) |
| prenyl diphosphate (CHEBI:16057) has role mouse metabolite (CHEBI:75771) |
| prenyl diphosphate (CHEBI:16057) has role phosphoantigen (CHEBI:59544) |
| prenyl diphosphate (CHEBI:16057) is a prenol phosphate (CHEBI:26250) |
| prenyl diphosphate (CHEBI:16057) is conjugate acid of prenyl diphosphate(3−) (CHEBI:57623) |
| Incoming Relation(s) |
| prenyl diphosphate(3−) (CHEBI:57623) is conjugate base of prenyl diphosphate (CHEBI:16057) |
| IUPAC Name |
|---|
| 3-methylbut-2-en-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| 2-Isopentenyl diphosphate | KEGG COMPOUND |
| 3,3-dimethylallyl pyrophosphate | ChemIDplus |
| 3-methylbut-2-enyl phosphono hydrogen phosphate | DrugBank |
| delta2-Isopentenyl diphosphate | KEGG COMPOUND |
| delta-Prenyl diphosphate | KEGG COMPOUND |
| Dimethylallyl diphosphate | KEGG COMPOUND |
| Citations |
|---|