EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O14 |
| Net Charge | 0 |
| Average Mass | 564.496 |
| Monoisotopic Mass | 564.14791 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[C@@H]3OC[C@](O)(CO)[C@H]3O)cc(O)c12 |
| InChI | InChI=1S/C26H28O14/c27-8-18-20(32)21(33)22(40-25-23(34)26(35,9-28)10-36-25)24(39-18)37-13-5-14(30)19-15(31)7-16(38-17(19)6-13)11-1-3-12(29)4-2-11/h1-7,18,20-25,27-30,32-35H,8-10H2/t18-,20-,21+,22-,23+,24-,25+,26-/m1/s1 |
| InChIKey | NTDLXWMIWOECHG-YRCFQSNFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apiin (CHEBI:15932) has functional parent apigenin (CHEBI:18388) |
| apiin (CHEBI:15932) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) |
| apiin (CHEBI:15932) has role plant metabolite (CHEBI:76924) |
| apiin (CHEBI:15932) is a dihydroxyflavone (CHEBI:38686) |
| apiin (CHEBI:15932) is a glycosyloxyflavone (CHEBI:50018) |
| apiin (CHEBI:15932) is a β-D-glucoside (CHEBI:22798) |
| apiin (CHEBI:15932) is conjugate acid of apiin(1−) (CHEBI:77640) |
| Incoming Relation(s) |
| malonylapiin (CHEBI:6664) has functional parent apiin (CHEBI:15932) |
| apiin(1−) (CHEBI:77640) is conjugate base of apiin (CHEBI:15932) |
| IUPAC Names |
|---|
| 5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl 2-O-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl]-β-D-glucopyranoside |
| 5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl 3-C-(hydroxymethyl)-β-D-glycero-tetrofuranosyl-(1→2)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 5,7,4'-trihydroxyflavone 7-O-[β-D-apiosyl-(1→2)-β-D-glucoside] | ChEBI |
| 7-((2-O-beta-D-Apiofuranosyl-beta-D-glucopyranosyl)oxy)-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyranone | ChemIDplus |
| 7-[(2-O-D-Apio-beta-D-furanosyl-beta-D-glucopyranosyl)oxy]-5-hydroxy-2-(4-hydroxy-phenyl)-4H-1-benzopyran-4-one | KEGG COMPOUND |
| 7-O-(beta-D-Apiofuranosyl-1,2-beta-D-glucosyl)-5,7,4'-trihydroxyflavone | KEGG COMPOUND |
| 7-O-(beta-D-Apiofuranosyl-1,2-beta-D-glucosyl)-5,7,4'-trihydroxyflavone | KEGG COMPOUND |
| apigenin 7-O-[β-D-apiosyl-(1→2)-β-D-glucoside] | IUBMB |
| Manual Xrefs | Databases |
|---|---|
| 7-O-BETA-D-APIOFURANOSYL-12-BETA-D-GLU | MetaCyc |
| Apiin | Wikipedia |
| C00001019 | KNApSAcK |
| C04858 | KEGG COMPOUND |
| C04858 | KEGG COMPOUND |
| CN1284492 | Patent |
| CN1413643 | Patent |
| HMDB0030843 | HMDB |
| LMPK12110337 | LIPID MAPS |
| LSM-18987 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:72966 | Reaxys |
| CAS:26544-34-3 | ChemIDplus |
| CAS:26544-34-3 | KEGG COMPOUND |
| Citations |
|---|