EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16ClNO3 |
| Net Charge | 0 |
| Average Mass | 317.772 |
| Monoisotopic Mass | 317.08187 |
| SMILES | CCC(=O)Nc1ccc(C(=O)OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO3/c1-2-16(20)19-14-9-7-12(8-10-14)17(21)22-11-13-5-3-4-6-15(13)18/h3-10H,2,11H2,1H3,(H,19,20) |
| InChIKey | MKEXQWZOWQXPBG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(1-oxopropylamino)benzoic acid (2-chlorophenyl)methyl ester (CHEBI:122114) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-33557 | LINCS |