EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N2O5 |
| Net Charge | 0 |
| Average Mass | 382.416 |
| Monoisotopic Mass | 382.15287 |
| SMILES | CCOc1ncccc1C(=O)OCC(=O)c1cc(C)n(Cc2ccco2)c1C |
| InChI | InChI=1S/C21H22N2O5/c1-4-26-20-17(8-5-9-22-20)21(25)28-13-19(24)18-11-14(2)23(15(18)3)12-16-7-6-10-27-16/h5-11H,4,12-13H2,1-3H3 |
| InChIKey | DUNPAYSIWIBJPH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethoxy-3-pyridinecarboxylic acid [2-[1-(2-furanylmethyl)-2,5-dimethyl-3-pyrrolyl]-2-oxoethyl] ester (CHEBI:121969) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-ethoxy-3-pyridinecarboxylic acid [2-[1-(2-furanylmethyl)-2,5-dimethyl-3-pyrrolyl]-2-oxoethyl] ester (CHEBI:121969) is a pyridines (CHEBI:26421) |
| Manual Xrefs | Databases |
|---|---|
| LSM-33412 | LINCS |