EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15NO4 |
| Net Charge | 0 |
| Average Mass | 249.266 |
| Monoisotopic Mass | 249.10011 |
| SMILES | CCC(=O)NCC(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO4/c1-2-12(16)14-8-13(17)18-9-11(15)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,14,16) |
| InChIKey | ZSCYIFHRAOGUKU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(1-oxopropylamino)acetic acid phenacyl ester (CHEBI:121714) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-33157 | LINCS |