EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7NS2 |
| Net Charge | 0 |
| Average Mass | 181.285 |
| Monoisotopic Mass | 181.00199 |
| SMILES | CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C8H7NS2/c1-10-8-9-6-4-2-3-5-7(6)11-8/h2-5H,1H3 |
| InChIKey | UTBVIMLZIRIFFR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylthio-1,3-benzothiazole (CHEBI:1217) has parent hydride benzothiazole (CHEBI:45993) |
| 2-methylthio-1,3-benzothiazole (CHEBI:1217) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| 2-methylthio-1,3-benzothiazole (CHEBI:1217) has role xenobiotic metabolite (CHEBI:76206) |
| 2-methylthio-1,3-benzothiazole (CHEBI:1217) is a benzothiazoles (CHEBI:37947) |
| 2-methylthio-1,3-benzothiazole (CHEBI:1217) is a methyl sulfide (CHEBI:86315) |
| IUPAC Name |
|---|
| 2-(methylsulfanyl)-1,3-benzothiazole |
| Synonyms | Source |
|---|---|
| 2-Methylthiobenzothiazole | KEGG COMPOUND |
| MTBT | ChEBI |
| 2-(methylthio)benzothiazole | ChemIDplus |
| 2-(Methylmercapto)benzothiazole | ChemIDplus |
| Citations |
|---|