EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N2O6 |
| Net Charge | 0 |
| Average Mass | 330.296 |
| Monoisotopic Mass | 330.08519 |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N2O6/c1-23-14-8-7-11(9-13(14)18(21)22)16(20)24-10-15(19)17-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,17,19) |
| InChIKey | ACKHFLCJMXQPFM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxy-3-nitrobenzoic acid (2-anilino-2-oxoethyl) ester (CHEBI:121513) is a nitrobenzoic acid (CHEBI:25553) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32956 | LINCS |