EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO2 |
| Net Charge | 0 |
| Average Mass | 163.176 |
| Monoisotopic Mass | 163.06333 |
| SMILES | Nc1cccc(C=CC(=O)O)c1 |
| InChI | InChI=1S/C9H9NO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6H,10H2,(H,11,12) |
| InChIKey | JNXMJSYJCFTLJB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3-aminophenyl)-2-propenoic acid (CHEBI:121499) is a cinnamic acids (CHEBI:23252) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32942 | LINCS |