EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19N3O |
| Net Charge | 0 |
| Average Mass | 329.403 |
| Monoisotopic Mass | 329.15281 |
| SMILES | Cc1cccc(NC(=O)c2cc3c(nc4ccccc43)c(C)n2)c1C |
| InChI | InChI=1S/C21H19N3O/c1-12-7-6-10-17(13(12)2)24-21(25)19-11-16-15-8-4-5-9-18(15)23-20(16)14(3)22-19/h4-11,23H,1-3H3,(H,24,25) |
| InChIKey | NMOFTYLBXGDJGZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2,3-dimethylphenyl)-1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide (CHEBI:121460) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32903 | LINCS |