EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17ClN2O3 |
| Net Charge | 0 |
| Average Mass | 320.776 |
| Monoisotopic Mass | 320.09277 |
| SMILES | CCCCOc1ccc(Nc2cc(Cl)ccc2C(=O)O)cn1 |
| InChI | InChI=1S/C16H17ClN2O3/c1-2-3-8-22-15-7-5-12(10-18-15)19-14-9-11(17)4-6-13(14)16(20)21/h4-7,9-10,19H,2-3,8H2,1H3,(H,20,21) |
| InChIKey | VJFNMPCCIPJOHB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(6-butoxy-3-pyridinyl)amino]-4-chlorobenzoic acid (CHEBI:121354) is a aminobenzoic acid (CHEBI:22495) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32797 | LINCS |