EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21N3O7 |
| Net Charge | 0 |
| Average Mass | 439.424 |
| Monoisotopic Mass | 439.13795 |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(N2C(=O)CC(NNC(=O)c3ccc(C)cc3)C2=O)c1 |
| InChI | InChI=1S/C22H21N3O7/c1-12-4-6-13(7-5-12)19(27)24-23-17-11-18(26)25(20(17)28)16-9-14(21(29)31-2)8-15(10-16)22(30)32-3/h4-10,17,23H,11H2,1-3H3,(H,24,27) |
| InChIKey | MRJUFPTYMKONJH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[3-[[(4-methylphenyl)-oxomethyl]hydrazo]-2,5-dioxo-1-pyrrolidinyl]benzene-1,3-dicarboxylic acid dimethyl ester (CHEBI:121279) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32722 | LINCS |