EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N3O4 |
| Net Charge | 0 |
| Average Mass | 353.378 |
| Monoisotopic Mass | 353.13756 |
| SMILES | CC(C)NC(=O)c1ccccc1NC(=O)C=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N3O4/c1-13(2)20-19(24)16-8-3-4-9-17(16)21-18(23)11-10-14-6-5-7-15(12-14)22(25)26/h3-13H,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | LKFARCIUSZIGKW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[3-(3-nitrophenyl)-1-oxoprop-2-enyl]amino]-N-propan-2-ylbenzamide (CHEBI:121075) is a amidobenzoic acid (CHEBI:48470) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32518 | LINCS |