EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25NO5S |
| Net Charge | 0 |
| Average Mass | 367.467 |
| Monoisotopic Mass | 367.14534 |
| SMILES | COC(=O)COc1ccc(S(=O)(=O)NCCC2=CCCCC2)cc1C |
| InChI | InChI=1S/C18H25NO5S/c1-14-12-16(8-9-17(14)24-13-18(20)23-2)25(21,22)19-11-10-15-6-4-3-5-7-15/h6,8-9,12,19H,3-5,7,10-11,13H2,1-2H3 |
| InChIKey | GJWFAJZZPLUEFK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[4-[2-(1-cyclohexenyl)ethylsulfamoyl]-2-methylphenoxy]acetic acid methyl ester (CHEBI:121035) is a monocarboxylic acid (CHEBI:25384) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32478 | LINCS |