EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClN2O3 |
| Net Charge | 0 |
| Average Mass | 388.895 |
| Monoisotopic Mass | 388.15537 |
| SMILES | COCCCNCC1C(Oc2ccc(Cl)cc2)C(=O)N1c1ccccc1C |
| InChI | InChI=1S/C21H25ClN2O3/c1-15-6-3-4-7-18(15)24-19(14-23-12-5-13-26-2)20(21(24)25)27-17-10-8-16(22)9-11-17/h3-4,6-11,19-20,23H,5,12-14H2,1-2H3 |
| InChIKey | VRJHWQQXRLCCET-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-chlorophenoxy)-4-[(3-methoxypropylamino)methyl]-1-(2-methylphenyl)-2-azetidinone (CHEBI:120998) is a monobactam (CHEBI:50695) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32441 | LINCS |