EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14BrN3OS |
| Net Charge | 0 |
| Average Mass | 376.279 |
| Monoisotopic Mass | 375.00410 |
| SMILES | O=C(Nc1ncc(Br)s1)C(Cc1ccccc1)n1cccc1 |
| InChI | InChI=1S/C16H14BrN3OS/c17-14-11-18-16(22-14)19-15(21)13(20-8-4-5-9-20)10-12-6-2-1-3-7-12/h1-9,11,13H,10H2,(H,18,19,21) |
| InChIKey | PTAKBWDNPCFDBB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(5-bromo-2-thiazolyl)-3-phenyl-2-(1-pyrrolyl)propanamide (CHEBI:120844) is a amphetamines (CHEBI:35338) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32287 | LINCS |