EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13ClN2O2 |
| Net Charge | 0 |
| Average Mass | 300.745 |
| Monoisotopic Mass | 300.06656 |
| SMILES | O=C(O)c1cc(NN=CC=Cc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C16H13ClN2O2/c17-15-9-8-13(11-14(15)16(20)21)19-18-10-4-7-12-5-2-1-3-6-12/h1-11,19H,(H,20,21) |
| InChIKey | IIYBXMWVSGZMSX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chloro-5-(2-cinnamylidenehydrazinyl)benzoic acid (CHEBI:120816) is a benzoic acids (CHEBI:22723) |
| 2-chloro-5-(2-cinnamylidenehydrazinyl)benzoic acid (CHEBI:120816) is a organohalogen compound (CHEBI:17792) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32259 | LINCS |