EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22N6O |
| Net Charge | 0 |
| Average Mass | 422.492 |
| Monoisotopic Mass | 422.18551 |
| SMILES | Cn1cccc1-c1cc(C(=O)N2CCc3c(nc4ccccc34)C2c2ccccn2)nn1 |
| InChI | InChI=1S/C25H22N6O/c1-30-13-6-10-22(30)20-15-21(29-28-20)25(32)31-14-11-17-16-7-2-3-8-18(16)27-23(17)24(31)19-9-4-5-12-26-19/h2-10,12-13,15,24,27H,11,14H2,1H3,(H,28,29) |
| InChIKey | SFBMMSWLODLMIY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [3-(1-methyl-2-pyrrolyl)-1H-pyrazol-5-yl]-[1-(2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (CHEBI:120792) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32234 | LINCS |