EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N2O2S |
| Net Charge | 0 |
| Average Mass | 288.372 |
| Monoisotopic Mass | 288.09325 |
| SMILES | CN(C)S(=O)(=O)Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C15H16N2O2S/c1-17(2)20(18,19)16-13-7-8-15-12(10-13)9-11-5-3-4-6-14(11)15/h3-8,10,16H,9H2,1-2H3 |
| InChIKey | CDAYLDNAWVABDZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(dimethylsulfamoylamino)-9H-fluorene (CHEBI:120753) is a fluorenes (CHEBI:24059) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32195 | LINCS |