EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N2O |
| Net Charge | 0 |
| Average Mass | 244.338 |
| Monoisotopic Mass | 244.15756 |
| SMILES | O=C(NC1CCCCC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H20N2O/c18-15(16-13-7-2-1-3-8-13)17-11-10-12-6-4-5-9-14(12)17/h4-6,9,13H,1-3,7-8,10-11H2,(H,16,18) |
| InChIKey | OSIPNWACISSEHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-cyclohexyl-2,3-dihydroindole-1-carboxamide (CHEBI:120643) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32085 | LINCS |