EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O6 |
| Net Charge | 0 |
| Average Mass | 384.388 |
| Monoisotopic Mass | 384.13214 |
| SMILES | COC(=O)c1nc2cc(OC)c(OC)cc2c1NC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H20N2O6/c1-25-12-7-5-6-11(8-12)19(23)22-17-13-9-15(26-2)16(27-3)10-14(13)21-18(17)20(24)28-4/h5-10,21H,1-4H3,(H,22,23) |
| InChIKey | UTDXHEHIDDGBFV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6-dimethoxy-3-[[(3-methoxyphenyl)-oxomethyl]amino]-1H-indole-2-carboxylic acid methyl ester (CHEBI:120403) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-31846 | LINCS |