EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7O3S |
| Net Charge | -1 |
| Average Mass | 147.175 |
| Monoisotopic Mass | 147.01214 |
| SMILES | CSCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C5H8O3S/c1-9-3-2-4(6)5(7)8/h2-3H2,1H3,(H,7,8)/p-1 |
| InChIKey | SXFSQZDSUWACKX-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylthio-2-oxobutanoate (CHEBI:16723) has functional parent butyrate (CHEBI:17968) |
| 4-methylthio-2-oxobutanoate (CHEBI:16723) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 4-methylthio-2-oxobutanoate (CHEBI:16723) has role human metabolite (CHEBI:77746) |
| 4-methylthio-2-oxobutanoate (CHEBI:16723) is a ω-(methylthio)-2-oxocarboxylate (CHEBI:133493) |
| 4-methylthio-2-oxobutanoate (CHEBI:16723) is conjugate base of 4-methylthio-2-oxobutanoic acid (CHEBI:33574) |
| Incoming Relation(s) |
| S-adenosyl-4-methylthio-2-oxobutanoate (CHEBI:16490) has functional parent 4-methylthio-2-oxobutanoate (CHEBI:16723) |
| 4-methylthio-2-oxobutanoic acid (CHEBI:33574) is conjugate acid of 4-methylthio-2-oxobutanoate (CHEBI:16723) |
| IUPAC Name |
|---|
| 4-(methylsulfanyl)-2-oxobutanoate |
| Synonym | Source |
|---|---|
| 2-oxo-4-methylthiobutanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-methylsulfanyl-2-oxobutanoate | UniProt |
| Citations |
|---|