EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2O3S |
| Net Charge | 0 |
| Average Mass | 346.452 |
| Monoisotopic Mass | 346.13511 |
| SMILES | CCCCC(Sc1nc(C)c(Cc2ccccc2)c(=O)n1)C(=O)O |
| InChI | InChI=1S/C18H22N2O3S/c1-3-4-10-15(17(22)23)24-18-19-12(2)14(16(21)20-18)11-13-8-6-5-7-9-13/h5-9,15H,3-4,10-11H2,1-2H3,(H,22,23)(H,19,20,21) |
| InChIKey | CQKPUBAOCCCNJW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[6-methyl-4-oxo-5-(phenylmethyl)-1H-pyrimidin-2-yl]thio]hexanoic acid (CHEBI:120059) is a medium-chain fatty acid (CHEBI:59554) |
| Manual Xrefs | Databases |
|---|---|
| LSM-31502 | LINCS |