EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25NO5S2 |
| Net Charge | 0 |
| Average Mass | 399.534 |
| Monoisotopic Mass | 399.11741 |
| SMILES | CC(C)CN(C(=O)COC(=O)c1cc2c(s1)CCC2)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H25NO5S2/c1-12(2)9-19(14-6-7-26(22,23)11-14)17(20)10-24-18(21)16-8-13-4-3-5-15(13)25-16/h8,12,14H,3-7,9-11H2,1-2H3 |
| InChIKey | RDUQAOLDJRZPCF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylic acid [2-[(1,1-dioxo-3-thiolanyl)-(2-methylpropyl)amino]-2-oxoethyl] ester (CHEBI:119947) is a thiophenecarboxylic acid (CHEBI:48436) |
| Manual Xrefs | Databases |
|---|---|
| LSM-31390 | LINCS |