EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N3O4S |
| Net Charge | 0 |
| Average Mass | 333.369 |
| Monoisotopic Mass | 333.07833 |
| SMILES | COC1=CC=CC(=CNNC(=O)CNC(=O)c2cccs2)C1=O |
| InChI | InChI=1S/C15H15N3O4S/c1-22-11-5-2-4-10(14(11)20)8-17-18-13(19)9-16-15(21)12-6-3-7-23-12/h2-8,17H,9H2,1H3,(H,16,21)(H,18,19) |
| InChIKey | WZGZTJILVAIMJJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-[(5-methoxy-6-oxo-1-cyclohexa-2,4-dienylidene)methylhydrazo]-2-oxoethyl]-2-thiophenecarboxamide (CHEBI:119898) is a N-acyl-amino acid (CHEBI:51569) |
| Manual Xrefs | Databases |
|---|---|
| LSM-31342 | LINCS |