EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8FNO3 |
| Net Charge | 0 |
| Average Mass | 137.110 |
| Monoisotopic Mass | 137.04882 |
| SMILES | N[C@H](C(=O)O)[C@H](O)CF |
| InChI | InChI=1S/C4H8FNO3/c5-1-2(7)3(6)4(8)9/h2-3,7H,1,6H2,(H,8,9)/t2-,3+/m1/s1 |
| InChIKey | GTFWIYJIEXNAOL-GBXIJSLDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-fluoro-L-threonine (CHEBI:11986) is a L-threonine derivative (CHEBI:84189) |
| 4-fluoro-L-threonine (CHEBI:11986) is a fluoroamino acid (CHEBI:24068) |
| 4-fluoro-L-threonine (CHEBI:11986) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 4-fluoro-L-threonine (CHEBI:11986) is tautomer of 4-fluoro-L-threonine zwitterion (CHEBI:57264) |
| Incoming Relation(s) |
| 4-fluoro-L-threonine zwitterion (CHEBI:57264) is tautomer of 4-fluoro-L-threonine (CHEBI:11986) |
| IUPAC Name |
|---|
| 4-fluoro-L-threonine |
| Synonyms | Source |
|---|---|
| (2S,3S)-2-amino-4-fluoro-3-hydroxybutanoic acid | IUPAC |
| 4-fluorothreonine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C15533 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4372061 | Beilstein |
| CAS:102130-93-8 | ChemIDplus |