EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O |
| Net Charge | 0 |
| Average Mass | 108.140 |
| Monoisotopic Mass | 108.05751 |
| SMILES | Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3 |
| InChIKey | IWDCLRJOBJJRNH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. uremic toxin A toxin that accumulates in patients with chronic kidney disease. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fungicide A substance used to destroy fungal pests. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-cresol (CHEBI:17847) has role Escherichia coli metabolite (CHEBI:76971) |
| p-cresol (CHEBI:17847) has role human metabolite (CHEBI:77746) |
| p-cresol (CHEBI:17847) has role uremic toxin (CHEBI:64584) |
| p-cresol (CHEBI:17847) is a cresol (CHEBI:25399) |
| Incoming Relation(s) |
| p-cresol sulfate (CHEBI:82914) has functional parent p-cresol (CHEBI:17847) |
| 4-(trifluoromethyl)phenol (CHEBI:42578) has functional parent p-cresol (CHEBI:17847) |
| tolterodine (CHEBI:9622) has functional parent p-cresol (CHEBI:17847) |
| IUPAC Name |
|---|
| 4-methylphenol |
| Synonyms | Source |
|---|---|
| 1-hydroxy-4-methylbenzene | NIST Chemistry WebBook |
| 4-Cresol | KEGG COMPOUND |
| 4-Hydroxytoluene | KEGG COMPOUND |
| 4-Methylphenol | KEGG COMPOUND |
| p-Kresol | NIST Chemistry WebBook |
| p-methylphenol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 4-methylphenol | UniProt |
| Citations |
|---|