EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H37N3O5S |
| Net Charge | 0 |
| Average Mass | 527.687 |
| Monoisotopic Mass | 527.24539 |
| SMILES | CCS(=O)(=O)N(C)C[C@H]1OCc2ccccc2-c2c(n(C)c3ccccc23)C(=O)N([C@H](C)CO)C[C@H]1C |
| InChI | InChI=1S/C28H37N3O5S/c1-6-37(34,35)29(4)16-25-19(2)15-31(20(3)17-32)28(33)27-26(22-12-8-7-11-21(22)18-36-25)23-13-9-10-14-24(23)30(27)5/h7-14,19-20,25,32H,6,15-18H2,1-5H3/t19-,20-,25-/m1/s1 |
| InChIKey | DWJGCUYEXVCCPK-UMEGOILYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-30867 (CHEBI:119418) is a indolyl carboxylic acid (CHEBI:46867) |
| Manual Xrefs | Databases |
|---|---|
| LSM-30867 | LINCS |